C13H20N6O2S — CID 118740747
8-propylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 118740747) has the molecular formula C13H20N6O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 8-propylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | 8-propylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 118740747 |
| Molecular Formula | C13H20N6O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 8-propylsulfonyl-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | CCCS(=O)(=O)N1Cc2nccn2CC(Cn2cncn2)C1 |
| InChI | InChI=1S/C13H20N6O2S/c1-2-5-22(20,21)19-8-12(7-18-11-14-10-16-18)6-17-4-3-15-13(17)9-19/h3-4,10-12H,2,5-9H2,1H3 |
| InChIKey | ZSUHTFOGVWKTHM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |