C14H22N6O2S — CID 118739694
6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-ethylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 118739694) has the molecular formula C14H22N6O2S and a molecular weight of 338.44 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-ethylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-ethylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 118739694 |
| Molecular Formula | C14H22N6O2S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-ethylsulfonyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | CCS(=O)(=O)N1Cc2nccn2CC(Cn2nc(C)nc2C)C1 |
| InChI | InChI=1S/C14H22N6O2S/c1-4-23(21,22)19-8-13(7-18-6-5-15-14(18)10-19)9-20-12(3)16-11(2)17-20/h5-6,13H,4,7-10H2,1-3H3 |
| InChIKey | HDVPMFSIRGOBFC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |