About (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one
(2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one (PubChem CID 104903447) has the molecular formula C12H20N4O
and a molecular weight of 236.32 g/mol. Its IUPAC name is (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one.
Molecular Properties
| Compound Name | (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one |
| PubChem CID | 104903447 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one |
| SMILES | CC(C)C[C@@H](N)C(=O)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H20N4O/c1-9(2)7-10(13)12(17)16-6-5-15-4-3-14-11(15)8-16/h3-4,9-10H,5-8,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | PUFAWJOANPHLQL-SNVBAGLBSA-N |
| XLogP | 0.60 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one?
The IUPAC name of (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one (CID 104903447) is (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one.
What is the SMILES notation for (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one?
The canonical SMILES for (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one is CC(C)C[C@@H](N)C(=O)N1CCn2ccnc2C1.
What is the InChIKey of (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one?
The InChIKey is PUFAWJOANPHLQL-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H20N4O/c1-9(2)7-10(13)12(17)16-6-5-15-4-3-14-11(15)8-16/h3-4,9-10H,5-8,13H2,1-2H3/t10-/m1/s1.
What are the key properties of (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one?
(2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one has a molecular weight of 236.32 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-4-methylpentan-1-one is sourced from PubChem (CID 104903447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).