C12H17ClN8 — CID 64575281
4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,N-diethyl-1,3,5-triazin-2-amine (PubChem CID 64575281) has the molecular formula C12H17ClN8 and a molecular weight of 308.78 g/mol. Its IUPAC name is 4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,N-diethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,N-diethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 64575281 |
| Molecular Formula | C12H17ClN8 |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,N-diethyl-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(Cl)nc(N2CCn3cnnc3C2)n1 |
| InChI | InChI=1S/C12H17ClN8/c1-3-19(4-2)11-15-10(13)16-12(17-11)20-5-6-21-8-14-18-9(21)7-20/h8H,3-7H2,1-2H3 |
| InChIKey | AJXCYQXYRWUAID-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |