C10H13ClN8 — CID 80843798
4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 80843798) has the molecular formula C10H13ClN8 and a molecular weight of 280.72 g/mol. Its IUPAC name is 4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80843798 |
| Molecular Formula | C10H13ClN8 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-chloro-6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(Cl)nc(N2CCn3cnnc3C2)n1 |
| InChI | InChI=1S/C10H13ClN8/c1-2-12-9-14-8(11)15-10(16-9)18-3-4-19-6-13-17-7(19)5-18/h6H,2-5H2,1H3,(H,12,14,15,16) |
| InChIKey | XYUTUUNQOQASQC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |