C12H18N8O — CID 80825850
4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-methoxy-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80825850) has the molecular formula C12H18N8O and a molecular weight of 290.33 g/mol. Its IUPAC name is 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-methoxy-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-methoxy-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80825850 |
| Molecular Formula | C12H18N8O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-6-methoxy-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(OC)nc(N2CCn3cnnc3C2)n1 |
| InChI | InChI=1S/C12H18N8O/c1-3-4-13-10-15-11(17-12(16-10)21-2)19-5-6-20-8-14-18-9(20)7-19/h8H,3-7H2,1-2H3,(H,13,15,16,17) |
| InChIKey | GLBVAPYDBYQMOP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |