C17H24N6O3 — CID 2180929
2-[[4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 2180929) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[[4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 2180929 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-[[4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | COc1ccc(N2CCN(c3nc(NCCO)nc(OC)n3)CC2)cc1 |
| InChI | InChI=1S/C17H24N6O3/c1-25-14-5-3-13(4-6-14)22-8-10-23(11-9-22)16-19-15(18-7-12-24)20-17(21-16)26-2/h3-6,24H,7-12H2,1-2H3,(H,18,19,20,21) |
| InChIKey | GLSXNYINYUHHCW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|