C22H25ClN6O3 — CID 2901969
N-(3-chloro-4-methoxyphenyl)-4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine (PubChem CID 2901969) has the molecular formula C22H25ClN6O3 and a molecular weight of 456.93 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2901969 |
| Molecular Formula | C22H25ClN6O3 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(N2CCN(c3nc(Nc4ccc(OC)c(Cl)c4)nc(OC)n3)CC2)cc1 |
| InChI | InChI=1S/C22H25ClN6O3/c1-30-17-7-5-16(6-8-17)28-10-12-29(13-11-28)21-25-20(26-22(27-21)32-3)24-15-4-9-19(31-2)18(23)14-15/h4-9,14H,10-13H2,1-3H3,(H,24,25,26,27) |
| InChIKey | SQVDIWBNJVCQHN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|