C21H22Cl2N6O2 — CID 1256691
4-chloro-N-(3-chloro-4-methoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine (PubChem CID 1256691) has the molecular formula C21H22Cl2N6O2 and a molecular weight of 461.35 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-4-methoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(3-chloro-4-methoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1256691 |
| Molecular Formula | C21H22Cl2N6O2 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-chloro-N-(3-chloro-4-methoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(N2CCN(c3nc(Cl)nc(Nc4ccc(OC)c(Cl)c4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H22Cl2N6O2/c1-30-16-6-4-15(5-7-16)28-9-11-29(12-10-28)21-26-19(23)25-20(27-21)24-14-3-8-18(31-2)17(22)13-14/h3-8,13H,9-12H2,1-2H3,(H,24,25,26,27) |
| InChIKey | CVQUJGWIWFMPPX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|