C18H20ClN7O — CID 171653777
N-(3-chloro-4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-4-amine (PubChem CID 171653777) has the molecular formula C18H20ClN7O and a molecular weight of 385.86 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-4-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-4-amine |
|---|---|
| PubChem CID | 171653777 |
| Molecular Formula | C18H20ClN7O |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-4-amine |
| SMILES | COc1ccc(Nc2nc(N3CCN(C)CC3)nc3nccnc23)cc1Cl |
| InChI | InChI=1S/C18H20ClN7O/c1-25-7-9-26(10-8-25)18-23-16-15(20-5-6-21-16)17(24-18)22-12-3-4-14(27-2)13(19)11-12/h3-6,11H,7-10H2,1-2H3,(H,21,22,23,24) |
| InChIKey | FWKDYAXZWDOPPS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |