C22H19ClN8O2 — CID 16910658
N-(4-chlorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]pteridin-4-amine (PubChem CID 16910658) has the molecular formula C22H19ClN8O2 and a molecular weight of 462.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]pteridin-4-amine.
| Compound Name | N-(4-chlorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]pteridin-4-amine |
|---|---|
| PubChem CID | 16910658 |
| Molecular Formula | C22H19ClN8O2 |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]pteridin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(c3nc(Nc4ccc(Cl)cc4)c4nccnc4n3)CC2)cc1 |
| InChI | InChI=1S/C22H19ClN8O2/c23-15-1-3-16(4-2-15)26-21-19-20(25-10-9-24-19)27-22(28-21)30-13-11-29(12-14-30)17-5-7-18(8-6-17)31(32)33/h1-10H,11-14H2,(H,25,26,27,28) |
| InChIKey | OXSVJBYHTHLESY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|