C23H23N7 — CID 16910730
N-(4-methylphenyl)-2-(4-phenylpiperazin-1-yl)pteridin-4-amine (PubChem CID 16910730) has the molecular formula C23H23N7 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-(4-phenylpiperazin-1-yl)pteridin-4-amine.
| Compound Name | N-(4-methylphenyl)-2-(4-phenylpiperazin-1-yl)pteridin-4-amine |
|---|---|
| PubChem CID | 16910730 |
| Molecular Formula | C23H23N7 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-(4-methylphenyl)-2-(4-phenylpiperazin-1-yl)pteridin-4-amine |
| SMILES | Cc1ccc(Nc2nc(N3CCN(c4ccccc4)CC3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C23H23N7/c1-17-7-9-18(10-8-17)26-22-20-21(25-12-11-24-20)27-23(28-22)30-15-13-29(14-16-30)19-5-3-2-4-6-19/h2-12H,13-16H2,1H3,(H,25,26,27,28) |
| InChIKey | XVJNZOWLONAGMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |