C23H22FN7O — CID 16820883
2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methoxyphenyl)pteridin-4-amine (PubChem CID 16820883) has the molecular formula C23H22FN7O and a molecular weight of 431.48 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methoxyphenyl)pteridin-4-amine.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methoxyphenyl)pteridin-4-amine |
|---|---|
| PubChem CID | 16820883 |
| Molecular Formula | C23H22FN7O |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methoxyphenyl)pteridin-4-amine |
| SMILES | COc1ccc(Nc2nc(N3CCN(c4ccc(F)cc4)CC3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C23H22FN7O/c1-32-19-8-4-17(5-9-19)27-22-20-21(26-11-10-25-20)28-23(29-22)31-14-12-30(13-15-31)18-6-2-16(24)3-7-18/h2-11H,12-15H2,1H3,(H,26,27,28,29) |
| InChIKey | IPQQLOUZUYEXIE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |