C20H21FN6O — CID 112961478
N-(4-fluorophenyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-triazin-3-amine (PubChem CID 112961478) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-triazin-3-amine.
| Compound Name | N-(4-fluorophenyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112961478 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-(4-fluorophenyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-triazin-3-amine |
| SMILES | COc1ccc(N2CCN(c3cnnc(Nc4ccc(F)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H21FN6O/c1-28-18-8-6-17(7-9-18)26-10-12-27(13-11-26)19-14-22-25-20(24-19)23-16-4-2-15(21)3-5-16/h2-9,14H,10-13H2,1H3,(H,23,24,25) |
| InChIKey | LLCZZBVJIQSWAI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|