C21H24N6O — CID 112946268
5-(4-ethylpiperazin-1-yl)-N-(4-phenoxyphenyl)-1,2,4-triazin-3-amine (PubChem CID 112946268) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-(4-ethylpiperazin-1-yl)-N-(4-phenoxyphenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-ethylpiperazin-1-yl)-N-(4-phenoxyphenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112946268 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-(4-ethylpiperazin-1-yl)-N-(4-phenoxyphenyl)-1,2,4-triazin-3-amine |
| SMILES | CCN1CCN(c2cnnc(Nc3ccc(Oc4ccccc4)cc3)n2)CC1 |
| InChI | InChI=1S/C21H24N6O/c1-2-26-12-14-27(15-13-26)20-16-22-25-21(24-20)23-17-8-10-19(11-9-17)28-18-6-4-3-5-7-18/h3-11,16H,2,12-15H2,1H3,(H,23,24,25) |
| InChIKey | DFXWCHMPIZBLNF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |