C14H18N6 — CID 112945843
5-(4-methylpiperazin-1-yl)-N-phenyl-1,2,4-triazin-3-amine (PubChem CID 112945843) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)-N-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-methylpiperazin-1-yl)-N-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112945843 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)-N-phenyl-1,2,4-triazin-3-amine |
| SMILES | CN1CCN(c2cnnc(Nc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C14H18N6/c1-19-7-9-20(10-8-19)13-11-15-18-14(17-13)16-12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H,16,17,18) |
| InChIKey | FFHWJGSYMPTGPC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |