C14H17BrN6 — CID 112945917
N-(3-bromophenyl)-5-(4-methylpiperazin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112945917) has the molecular formula C14H17BrN6 and a molecular weight of 349.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-5-(4-methylpiperazin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-(3-bromophenyl)-5-(4-methylpiperazin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112945917 |
| Molecular Formula | C14H17BrN6 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-(3-bromophenyl)-5-(4-methylpiperazin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CN1CCN(c2cnnc(Nc3cccc(Br)c3)n2)CC1 |
| InChI | InChI=1S/C14H17BrN6/c1-20-5-7-21(8-6-20)13-10-16-19-14(18-13)17-12-4-2-3-11(15)9-12/h2-4,9-10H,5-8H2,1H3,(H,17,18,19) |
| InChIKey | SSSXDKFIVXYNRV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |