C16H22N6O — CID 112946238
5-(4-ethylpiperazin-1-yl)-N-(3-methoxyphenyl)-1,2,4-triazin-3-amine (PubChem CID 112946238) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-(4-ethylpiperazin-1-yl)-N-(3-methoxyphenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-ethylpiperazin-1-yl)-N-(3-methoxyphenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112946238 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 5-(4-ethylpiperazin-1-yl)-N-(3-methoxyphenyl)-1,2,4-triazin-3-amine |
| SMILES | CCN1CCN(c2cnnc(Nc3cccc(OC)c3)n2)CC1 |
| InChI | InChI=1S/C16H22N6O/c1-3-21-7-9-22(10-8-21)15-12-17-20-16(19-15)18-13-5-4-6-14(11-13)23-2/h4-6,11-12H,3,7-10H2,1-2H3,(H,18,19,20) |
| InChIKey | OKCNPRYDCKRMSS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |