C23H28N6 — CID 112955475
N-(4-tert-butylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112955475) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-(4-tert-butylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112955475 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-(4-phenylpiperazin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CC(C)(C)c1ccc(Nc2nncc(N3CCN(c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H28N6/c1-23(2,3)18-9-11-19(12-10-18)25-22-26-21(17-24-27-22)29-15-13-28(14-16-29)20-7-5-4-6-8-20/h4-12,17H,13-16H2,1-3H3,(H,25,26,27) |
| InChIKey | LHPORAVYWFGIAZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |