C21H24FN7O — CID 3163543
2-N-(4-fluorophenyl)-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 3163543) has the molecular formula C21H24FN7O and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-fluorophenyl)-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3163543 |
| Molecular Formula | C21H24FN7O |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-N-(4-fluorophenyl)-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(N2CCN(Cc3nc(N)nc(Nc4ccc(F)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H24FN7O/c1-30-18-8-6-17(7-9-18)29-12-10-28(11-13-29)14-19-25-20(23)27-21(26-19)24-16-4-2-15(22)3-5-16/h2-9H,10-14H2,1H3,(H3,23,24,25,26,27) |
| InChIKey | JZAOPJQCWUGQFJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|