C23H23N7O — CID 39347028
N-(3-methoxyphenyl)-4-(4-phenylpiperazin-1-yl)pteridin-2-amine (PubChem CID 39347028) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-(4-phenylpiperazin-1-yl)pteridin-2-amine.
| Compound Name | N-(3-methoxyphenyl)-4-(4-phenylpiperazin-1-yl)pteridin-2-amine |
|---|---|
| PubChem CID | 39347028 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-(3-methoxyphenyl)-4-(4-phenylpiperazin-1-yl)pteridin-2-amine |
| SMILES | COc1cccc(Nc2nc(N3CCN(c4ccccc4)CC3)c3nccnc3n2)c1 |
| InChI | InChI=1S/C23H23N7O/c1-31-19-9-5-6-17(16-19)26-23-27-21-20(24-10-11-25-21)22(28-23)30-14-12-29(13-15-30)18-7-3-2-4-8-18/h2-11,16H,12-15H2,1H3,(H,25,26,27,28) |
| InChIKey | ZUJKDHXVGFOXGD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |