C22H22N8 — CID 45495177
4-(4-phenylpiperazin-1-yl)-N-(pyridin-2-ylmethyl)pteridin-2-amine (PubChem CID 45495177) has the molecular formula C22H22N8 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-(4-phenylpiperazin-1-yl)-N-(pyridin-2-ylmethyl)pteridin-2-amine.
| Compound Name | 4-(4-phenylpiperazin-1-yl)-N-(pyridin-2-ylmethyl)pteridin-2-amine |
|---|---|
| PubChem CID | 45495177 |
| Molecular Formula | C22H22N8 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-(4-phenylpiperazin-1-yl)-N-(pyridin-2-ylmethyl)pteridin-2-amine |
| SMILES | c1ccc(N2CCN(c3nc(NCc4ccccn4)nc4nccnc34)CC2)cc1 |
| InChI | InChI=1S/C22H22N8/c1-2-7-18(8-3-1)29-12-14-30(15-13-29)21-19-20(25-11-10-24-19)27-22(28-21)26-16-17-6-4-5-9-23-17/h1-11H,12-16H2,(H,25,26,27,28) |
| InChIKey | PWNLJCUBIJUERK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |