C20H24N6 — CID 16910766
2-N-cycloheptyl-4-N-(4-methylphenyl)pteridine-2,4-diamine (PubChem CID 16910766) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-N-cycloheptyl-4-N-(4-methylphenyl)pteridine-2,4-diamine.
| Compound Name | 2-N-cycloheptyl-4-N-(4-methylphenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910766 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-N-cycloheptyl-4-N-(4-methylphenyl)pteridine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(NC3CCCCCC3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C20H24N6/c1-14-8-10-16(11-9-14)23-19-17-18(22-13-12-21-17)25-20(26-19)24-15-6-4-2-3-5-7-15/h8-13,15H,2-7H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | XJWSNTCYHMXWGP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |