C21H20N6 — CID 16911015
4-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pteridine-2,4-diamine (PubChem CID 16911015) has the molecular formula C21H20N6 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pteridine-2,4-diamine.
| Compound Name | 4-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16911015 |
| Molecular Formula | C21H20N6 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)-2-N-(4-methylphenyl)pteridine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(Nc3cc(C)ccc3C)c3nccnc3n2)cc1 |
| InChI | InChI=1S/C21H20N6/c1-13-5-8-16(9-6-13)24-21-26-19-18(22-10-11-23-19)20(27-21)25-17-12-14(2)4-7-15(17)3/h4-12H,1-3H3,(H2,23,24,25,26,27) |
| InChIKey | QTATTWDYQIDNRA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |