C20H16Cl2N6 — CID 16911093
2-N,4-N-bis(4-chloro-2-methylphenyl)pteridine-2,4-diamine (PubChem CID 16911093) has the molecular formula C20H16Cl2N6 and a molecular weight of 411.30 g/mol. Its IUPAC name is 2-N,4-N-bis(4-chloro-2-methylphenyl)pteridine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(4-chloro-2-methylphenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16911093 |
| Molecular Formula | C20H16Cl2N6 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-N,4-N-bis(4-chloro-2-methylphenyl)pteridine-2,4-diamine |
| SMILES | Cc1cc(Cl)ccc1Nc1nc(Nc2ccc(Cl)cc2C)c2nccnc2n1 |
| InChI | InChI=1S/C20H16Cl2N6/c1-11-9-13(21)3-5-15(11)25-19-17-18(24-8-7-23-17)27-20(28-19)26-16-6-4-14(22)10-12(16)2/h3-10H,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | XNWQZEMCZXFWJO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |