C21H23ClN6 — CID 16911060
4-N-(4-chloro-2-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pteridine-2,4-diamine (PubChem CID 16911060) has the molecular formula C21H23ClN6 and a molecular weight of 394.91 g/mol. Its IUPAC name is 4-N-(4-chloro-2-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pteridine-2,4-diamine.
| Compound Name | 4-N-(4-chloro-2-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16911060 |
| Molecular Formula | C21H23ClN6 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-N-(4-chloro-2-methylphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]pteridine-2,4-diamine |
| SMILES | Cc1cc(Cl)ccc1Nc1nc(NCCC2=CCCCC2)nc2nccnc12 |
| InChI | InChI=1S/C21H23ClN6/c1-14-13-16(22)7-8-17(14)26-20-18-19(24-12-11-23-18)27-21(28-20)25-10-9-15-5-3-2-4-6-15/h5,7-8,11-13H,2-4,6,9-10H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | SUBPGCGZZACZLP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|