C16H18N6 — CID 16910978
4-N-(2,5-dimethylphenyl)-2-N-ethylpteridine-2,4-diamine (PubChem CID 16910978) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)-2-N-ethylpteridine-2,4-diamine.
| Compound Name | 4-N-(2,5-dimethylphenyl)-2-N-ethylpteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910978 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)-2-N-ethylpteridine-2,4-diamine |
| SMILES | CCNc1nc(Nc2cc(C)ccc2C)c2nccnc2n1 |
| InChI | InChI=1S/C16H18N6/c1-4-17-16-21-14-13(18-7-8-19-14)15(22-16)20-12-9-10(2)5-6-11(12)3/h5-9H,4H2,1-3H3,(H2,17,19,20,21,22) |
| InChIKey | KJZVGHBPCYLKQP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |