C15H22N6 — CID 7589380
2-N-(2,5-dimethylphenyl)-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 7589380) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-N-(2,5-dimethylphenyl)-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2,5-dimethylphenyl)-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 7589380 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-N-(2,5-dimethylphenyl)-4-N,6-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC)nc(Nc2cc(C)ccc2C)n1 |
| InChI | InChI=1S/C15H22N6/c1-5-16-13-19-14(17-6-2)21-15(20-13)18-12-9-10(3)7-8-11(12)4/h7-9H,5-6H2,1-4H3,(H3,16,17,18,19,20,21) |
| InChIKey | ZAZMKJOGVUOBJE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |