C19H24N6 — CID 16911002
4-N-(2,5-dimethylphenyl)-2-N-(3-methylbutyl)pteridine-2,4-diamine (PubChem CID 16911002) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)-2-N-(3-methylbutyl)pteridine-2,4-diamine.
| Compound Name | 4-N-(2,5-dimethylphenyl)-2-N-(3-methylbutyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16911002 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)-2-N-(3-methylbutyl)pteridine-2,4-diamine |
| SMILES | Cc1ccc(C)c(Nc2nc(NCCC(C)C)nc3nccnc23)c1 |
| InChI | InChI=1S/C19H24N6/c1-12(2)7-8-22-19-24-17-16(20-9-10-21-17)18(25-19)23-15-11-13(3)5-6-14(15)4/h5-6,9-12H,7-8H2,1-4H3,(H2,21,22,23,24,25) |
| InChIKey | JCUWMXMDLBLNTJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |