C16H17ClN6O — CID 16911072
1-[[4-(4-chloro-2-methylanilino)pteridin-2-yl]amino]propan-2-ol (PubChem CID 16911072) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is 1-[[4-(4-chloro-2-methylanilino)pteridin-2-yl]amino]propan-2-ol.
| Compound Name | 1-[[4-(4-chloro-2-methylanilino)pteridin-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 16911072 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[[4-(4-chloro-2-methylanilino)pteridin-2-yl]amino]propan-2-ol |
| SMILES | Cc1cc(Cl)ccc1Nc1nc(NCC(C)O)nc2nccnc12 |
| InChI | InChI=1S/C16H17ClN6O/c1-9-7-11(17)3-4-12(9)21-15-13-14(19-6-5-18-13)22-16(23-15)20-8-10(2)24/h3-7,10,24H,8H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | NXEAXMJFVINSCE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |