C16H15ClN6 — CID 16911051
4-N-(4-chloro-2-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine (PubChem CID 16911051) has the molecular formula C16H15ClN6 and a molecular weight of 326.79 g/mol. Its IUPAC name is 4-N-(4-chloro-2-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine.
| Compound Name | 4-N-(4-chloro-2-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine |
|---|---|
| PubChem CID | 16911051 |
| Molecular Formula | C16H15ClN6 |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-N-(4-chloro-2-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine |
| SMILES | C=CCNc1nc(Nc2ccc(Cl)cc2C)c2nccnc2n1 |
| InChI | InChI=1S/C16H15ClN6/c1-3-6-20-16-22-14-13(18-7-8-19-14)15(23-16)21-12-5-4-11(17)9-10(12)2/h3-5,7-9H,1,6H2,2H3,(H2,19,20,21,22,23) |
| InChIKey | KQZWTJJYDAKMQW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|