C16H16N6 — CID 16910744
4-N-(4-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine (PubChem CID 16910744) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 4-N-(4-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine.
| Compound Name | 4-N-(4-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910744 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-N-(4-methylphenyl)-2-N-prop-2-enylpteridine-2,4-diamine |
| SMILES | C=CCNc1nc(Nc2ccc(C)cc2)c2nccnc2n1 |
| InChI | InChI=1S/C16H16N6/c1-3-8-19-16-21-14-13(17-9-10-18-14)15(22-16)20-12-6-4-11(2)5-7-12/h3-7,9-10H,1,8H2,2H3,(H2,18,19,20,21,22) |
| InChIKey | YSRZOZLLVNFXIQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|