C17H20N6O2 — CID 16910759
2-[2-[[4-(4-methylanilino)pteridin-2-yl]amino]ethoxy]ethanol (PubChem CID 16910759) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-[2-[[4-(4-methylanilino)pteridin-2-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[4-(4-methylanilino)pteridin-2-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 16910759 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[2-[[4-(4-methylanilino)pteridin-2-yl]amino]ethoxy]ethanol |
| SMILES | Cc1ccc(Nc2nc(NCCOCCO)nc3nccnc23)cc1 |
| InChI | InChI=1S/C17H20N6O2/c1-12-2-4-13(5-3-12)21-16-14-15(19-7-6-18-14)22-17(23-16)20-8-10-25-11-9-24/h2-7,24H,8-11H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | UBWDINPWFXZWQU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|