C23H21N7 — CID 16910758
2-N-[2-(1H-indol-2-yl)ethyl]-4-N-(4-methylphenyl)pteridine-2,4-diamine (PubChem CID 16910758) has the molecular formula C23H21N7 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-N-[2-(1H-indol-2-yl)ethyl]-4-N-(4-methylphenyl)pteridine-2,4-diamine.
| Compound Name | 2-N-[2-(1H-indol-2-yl)ethyl]-4-N-(4-methylphenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910758 |
| Molecular Formula | C23H21N7 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-N-[2-(1H-indol-2-yl)ethyl]-4-N-(4-methylphenyl)pteridine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(NCCc3cc4ccccc4[nH]3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C23H21N7/c1-15-6-8-17(9-7-15)28-22-20-21(25-13-12-24-20)29-23(30-22)26-11-10-18-14-16-4-2-3-5-19(16)27-18/h2-9,12-14,27H,10-11H2,1H3,(H2,25,26,28,29,30) |
| InChIKey | BOSBFKPCYOJSBJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |