C18H15FN6S — CID 51699968
4-N-(4-fluorophenyl)-2-N-(2-thiophen-2-ylethyl)pteridine-2,4-diamine (PubChem CID 51699968) has the molecular formula C18H15FN6S and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-2-N-(2-thiophen-2-ylethyl)pteridine-2,4-diamine.
| Compound Name | 4-N-(4-fluorophenyl)-2-N-(2-thiophen-2-ylethyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 51699968 |
| Molecular Formula | C18H15FN6S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-N-(4-fluorophenyl)-2-N-(2-thiophen-2-ylethyl)pteridine-2,4-diamine |
| SMILES | Fc1ccc(Nc2nc(NCCc3cccs3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C18H15FN6S/c19-12-3-5-13(6-4-12)23-17-15-16(21-10-9-20-15)24-18(25-17)22-8-7-14-2-1-11-26-14/h1-6,9-11H,7-8H2,(H2,21,22,23,24,25) |
| InChIKey | OAESMOQKWVHPLS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |