C17H17N5OS — CID 71237297
4-anilino-2-(2-thiophen-2-ylethylamino)pyrimidine-5-carboxamide (PubChem CID 71237297) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-anilino-2-(2-thiophen-2-ylethylamino)pyrimidine-5-carboxamide.
| Compound Name | 4-anilino-2-(2-thiophen-2-ylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71237297 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-anilino-2-(2-thiophen-2-ylethylamino)pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(NCCc2cccs2)nc1Nc1ccccc1 |
| InChI | InChI=1S/C17H17N5OS/c18-15(23)14-11-20-17(19-9-8-13-7-4-10-24-13)22-16(14)21-12-5-2-1-3-6-12/h1-7,10-11H,8-9H2,(H2,18,23)(H2,19,20,21,22) |
| InChIKey | GBVBHUSJKANJSD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |