C14H18N6O2 — CID 15458392
2-(2-aminoethylamino)-4-(3-methoxyanilino)pyrimidine-5-carboxamide (PubChem CID 15458392) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-4-(3-methoxyanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-(2-aminoethylamino)-4-(3-methoxyanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 15458392 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-(2-aminoethylamino)-4-(3-methoxyanilino)pyrimidine-5-carboxamide |
| SMILES | COc1cccc(Nc2nc(NCCN)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C14H18N6O2/c1-22-10-4-2-3-9(7-10)19-13-11(12(16)21)8-18-14(20-13)17-6-5-15/h2-4,7-8H,5-6,15H2,1H3,(H2,16,21)(H2,17,18,19,20) |
| InChIKey | OGNMTHFRYMWMLE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |