C15H19N9O — CID 146884271
2-(2-aminoethylamino)-4-[3-[2-(2-iminoethylidene)hydrazinyl]anilino]pyrimidine-5-carboxamide (PubChem CID 146884271) has the molecular formula C15H19N9O and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-4-[3-[2-(2-iminoethylidene)hydrazinyl]anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-(2-aminoethylamino)-4-[3-[2-(2-iminoethylidene)hydrazinyl]anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 146884271 |
| Molecular Formula | C15H19N9O |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-(2-aminoethylamino)-4-[3-[2-(2-iminoethylidene)hydrazinyl]anilino]pyrimidine-5-carboxamide |
| SMILES | [H]/N=C/C=NNc1cccc(Nc2nc(NCCN)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C15H19N9O/c16-4-6-19-15-20-9-12(13(18)25)14(23-15)22-10-2-1-3-11(8-10)24-21-7-5-17/h1-3,5,7-9,17,24H,4,6,16H2,(H2,18,25)(H2,19,20,22,23)/b17-5+,21-7? |
| InChIKey | SUVWITACXOFUJM-FXZVRXOCSA-N |
| XLogP | 0.74 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|