C21H30N9O+ — CID 143890343
[5-[[2-[[(1S,2S)-2-aminocyclohexyl]methylamino]-5-carbamoylpyrimidin-4-yl]amino]-2-methylphenyl]-[(Z)-2-iminoethylideneamino]azanium (PubChem CID 143890343) has the molecular formula C21H30N9O+ and a molecular weight of 424.53 g/mol. Its IUPAC name is [5-[[2-[[(1S,2S)-2-aminocyclohexyl]methylamino]-5-carbamoylpyrimidin-4-yl]amino]-2-methylphenyl]-[(Z)-2-iminoethylideneamino]azanium.
| Compound Name | [5-[[2-[[(1S,2S)-2-aminocyclohexyl]methylamino]-5-carbamoylpyrimidin-4-yl]amino]-2-methylphenyl]-[(Z)-2-iminoethylideneamino]azanium |
|---|---|
| PubChem CID | 143890343 |
| Molecular Formula | C21H30N9O+ |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [5-[[2-[[(1S,2S)-2-aminocyclohexyl]methylamino]-5-carbamoylpyrimidin-4-yl]amino]-2-methylphenyl]-[(Z)-2-iminoethylideneamino]azanium |
| SMILES | [H]/N=C/C=N\[NH2+]c1cc(Nc2nc(NC[C@@H]3CCCC[C@@H]3N)ncc2C(N)=O)ccc1C |
| InChI | InChI=1S/C21H29N9O/c1-13-6-7-15(10-18(13)30-27-9-8-22)28-20-16(19(24)31)12-26-21(29-20)25-11-14-4-2-3-5-17(14)23/h6-10,12,14,17,22,30H,2-5,11,23H2,1H3,(H2,24,31)(H2,25,26,28,29)/p+1/b22-8+,27-9-/t14-,17-/m0/s1 |
| InChIKey | LJHKYMUJBUSHHE-XSQFYHJESA-O |
| XLogP | 1.39 |
| TPSA | 171.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|