C17H23N7O — CID 123987334
4-(3-aminoanilino)-2-[(2-aminocyclohexyl)amino]pyrimidine-5-carboxamide (PubChem CID 123987334) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-(3-aminoanilino)-2-[(2-aminocyclohexyl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-(3-aminoanilino)-2-[(2-aminocyclohexyl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123987334 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-(3-aminoanilino)-2-[(2-aminocyclohexyl)amino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCCCC2N)nc1Nc1cccc(N)c1 |
| InChI | InChI=1S/C17H23N7O/c18-10-4-3-5-11(8-10)22-16-12(15(20)25)9-21-17(24-16)23-14-7-2-1-6-13(14)19/h3-5,8-9,13-14H,1-2,6-7,18-19H2,(H2,20,25)(H2,21,22,23,24) |
| InChIKey | WWHMVMNWZHQMMG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|