C20H26N8O — CID 143890502
2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(Z)-1-amino-3-iminoprop-1-enyl]anilino]pyrimidine-5-carboxamide (PubChem CID 143890502) has the molecular formula C20H26N8O and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(Z)-1-amino-3-iminoprop-1-enyl]anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(Z)-1-amino-3-iminoprop-1-enyl]anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 143890502 |
| Molecular Formula | C20H26N8O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(Z)-1-amino-3-iminoprop-1-enyl]anilino]pyrimidine-5-carboxamide |
| SMILES | [H]/N=C/C=C(\N)c1cccc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C20H26N8O/c21-9-8-15(22)12-4-3-5-13(10-12)26-19-14(18(24)29)11-25-20(28-19)27-17-7-2-1-6-16(17)23/h3-5,8-11,16-17,21H,1-2,6-7,22-23H2,(H2,24,29)(H2,25,26,27,28)/b15-8-,21-9+/t16-,17+/m0/s1 |
| InChIKey | JYKVMEKHGOEQBT-ADBYMCFGSA-N |
| XLogP | 1.95 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|