C21H30N8O — CID 123167632
2-[(2-aminocyclohexyl)amino]-4-[3-(4-iminobutan-2-ylamino)anilino]pyrimidine-5-carboxamide (PubChem CID 123167632) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is 2-[(2-aminocyclohexyl)amino]-4-[3-(4-iminobutan-2-ylamino)anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-[(2-aminocyclohexyl)amino]-4-[3-(4-iminobutan-2-ylamino)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123167632 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-[(2-aminocyclohexyl)amino]-4-[3-(4-iminobutan-2-ylamino)anilino]pyrimidine-5-carboxamide |
| SMILES | [H]/N=C/CC(C)Nc1cccc(Nc2nc(NC3CCCCC3N)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C21H30N8O/c1-13(9-10-22)26-14-5-4-6-15(11-14)27-20-16(19(24)30)12-25-21(29-20)28-18-8-3-2-7-17(18)23/h4-6,10-13,17-18,22,26H,2-3,7-9,23H2,1H3,(H2,24,30)(H2,25,27,28,29)/b22-10+ |
| InChIKey | OEESRGRGPKZMOE-LSHDLFTRSA-N |
| XLogP | 2.84 |
| TPSA | 154.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|