C24H28N6O2 — CID 143890446
2-[(2-aminocyclohexyl)amino]-4-(dibenzofuran-3-ylamino)pyrimidine-5-carboxamide;methane (PubChem CID 143890446) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[(2-aminocyclohexyl)amino]-4-(dibenzofuran-3-ylamino)pyrimidine-5-carboxamide;methane.
| Compound Name | 2-[(2-aminocyclohexyl)amino]-4-(dibenzofuran-3-ylamino)pyrimidine-5-carboxamide;methane |
|---|---|
| PubChem CID | 143890446 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[(2-aminocyclohexyl)amino]-4-(dibenzofuran-3-ylamino)pyrimidine-5-carboxamide;methane |
| SMILES | C.NC(=O)c1cnc(NC2CCCCC2N)nc1Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C23H24N6O2.CH4/c24-17-6-2-3-7-18(17)28-23-26-12-16(21(25)30)22(29-23)27-13-9-10-15-14-5-1-4-8-19(14)31-20(15)11-13;/h1,4-5,8-12,17-18H,2-3,6-7,24H2,(H2,25,30)(H2,26,27,28,29);1H4 |
| InChIKey | XIUZVTJVVBNHSR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 132.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |