C13H14BrN8O+ — CID 163891415
[3-[(2-amino-5-carbamoylpyrimidin-4-yl)amino]-5-bromophenyl]-(2-iminoethylideneamino)azanium (PubChem CID 163891415) has the molecular formula C13H14BrN8O+ and a molecular weight of 378.21 g/mol. Its IUPAC name is [3-[(2-amino-5-carbamoylpyrimidin-4-yl)amino]-5-bromophenyl]-(2-iminoethylideneamino)azanium.
| Compound Name | [3-[(2-amino-5-carbamoylpyrimidin-4-yl)amino]-5-bromophenyl]-(2-iminoethylideneamino)azanium |
|---|---|
| PubChem CID | 163891415 |
| Molecular Formula | C13H14BrN8O+ |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | [3-[(2-amino-5-carbamoylpyrimidin-4-yl)amino]-5-bromophenyl]-(2-iminoethylideneamino)azanium |
| SMILES | [H]/N=C/C=N[NH2+]c1cc(Br)cc(Nc2nc(N)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C13H13BrN8O/c14-7-3-8(5-9(4-7)22-19-2-1-15)20-12-10(11(16)23)6-18-13(17)21-12/h1-6,15,22H,(H2,16,23)(H3,17,18,20,21)/p+1/b15-1+,19-2? |
| InChIKey | QBWBNPXDPJKTJP-SOXSICTMSA-O |
| XLogP | 0.49 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|