C14H15N7OS — CID 123511231
4-[3-(2-iminoethyldiazenyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 123511231) has the molecular formula C14H15N7OS and a molecular weight of 329.39 g/mol. Its IUPAC name is 4-[3-(2-iminoethyldiazenyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | 4-[3-(2-iminoethyldiazenyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123511231 |
| Molecular Formula | C14H15N7OS |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-[3-(2-iminoethyldiazenyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | [H]/N=C/C/N=N/c1cccc(Nc2nc(SC)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C14H15N7OS/c1-23-14-17-8-11(12(16)22)13(20-14)19-9-3-2-4-10(7-9)21-18-6-5-15/h2-5,7-8,15H,6H2,1H3,(H2,16,22)(H,17,19,20)/b15-5+,21-18+ |
| InChIKey | SNKQNKAMSXFFPY-SDWQBWCCSA-N |
| XLogP | 2.77 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|