C12H12N4OS2 — CID 164926217
4-(3-aminosulfanylanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde (PubChem CID 164926217) has the molecular formula C12H12N4OS2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 4-(3-aminosulfanylanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde.
| Compound Name | 4-(3-aminosulfanylanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 164926217 |
| Molecular Formula | C12H12N4OS2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 4-(3-aminosulfanylanilino)-2-methylsulfanylpyrimidine-5-carbaldehyde |
| SMILES | CSc1ncc(C=O)c(Nc2cccc(SN)c2)n1 |
| InChI | InChI=1S/C12H12N4OS2/c1-18-12-14-6-8(7-17)11(16-12)15-9-3-2-4-10(5-9)19-13/h2-7H,13H2,1H3,(H,14,15,16) |
| InChIKey | BNKPZXXVZUVUTR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|