C15H19N5O2S — CID 169232854
4-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]amino]-2-methylsulfanylpyrimidine-5-carbaldehyde (PubChem CID 169232854) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 4-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]amino]-2-methylsulfanylpyrimidine-5-carbaldehyde.
| Compound Name | 4-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]amino]-2-methylsulfanylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 169232854 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]amino]-2-methylsulfanylpyrimidine-5-carbaldehyde |
| SMILES | CSc1ncc(C=O)c(Nc2ccc(OCCN(C)C)nc2)n1 |
| InChI | InChI=1S/C15H19N5O2S/c1-20(2)6-7-22-13-5-4-12(9-16-13)18-14-11(10-21)8-17-15(19-14)23-3/h4-5,8-10H,6-7H2,1-3H3,(H,17,18,19) |
| InChIKey | IDGDMZSFXWVRFG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|