C16H19FN4OS — CID 176656316
4-[4-[2-(dimethylamino)ethoxy]-3-fluoroanilino]-2-methylpyrimidine-5-carbothialdehyde (PubChem CID 176656316) has the molecular formula C16H19FN4OS and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[4-[2-(dimethylamino)ethoxy]-3-fluoroanilino]-2-methylpyrimidine-5-carbothialdehyde.
| Compound Name | 4-[4-[2-(dimethylamino)ethoxy]-3-fluoroanilino]-2-methylpyrimidine-5-carbothialdehyde |
|---|---|
| PubChem CID | 176656316 |
| Molecular Formula | C16H19FN4OS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-[4-[2-(dimethylamino)ethoxy]-3-fluoroanilino]-2-methylpyrimidine-5-carbothialdehyde |
| SMILES | Cc1ncc(C=S)c(Nc2ccc(OCCN(C)C)c(F)c2)n1 |
| InChI | InChI=1S/C16H19FN4OS/c1-11-18-9-12(10-23)16(19-11)20-13-4-5-15(14(17)8-13)22-7-6-21(2)3/h4-5,8-10H,6-7H2,1-3H3,(H,18,19,20) |
| InChIKey | JVVIEDMZCJHZLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|