C17H17F2NO2 — CID 87737104
5-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethoxy]benzaldehyde (PubChem CID 87737104) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethoxy]benzaldehyde.
| Compound Name | 5-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 87737104 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-(2,6-difluorophenyl)-2-[2-(dimethylamino)ethoxy]benzaldehyde |
| SMILES | CN(C)CCOc1ccc(-c2c(F)cccc2F)cc1C=O |
| InChI | InChI=1S/C17H17F2NO2/c1-20(2)8-9-22-16-7-6-12(10-13(16)11-21)17-14(18)4-3-5-15(17)19/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | AYAUCIDCBBELSL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|