C27H28FNO2 — CID 69218969
3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 69218969) has the molecular formula C27H28FNO2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | 3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69218969 |
| Molecular Formula | C27H28FNO2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C)cc(-c2ccc(OCCN(C)C)c(C=CC(=O)c3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C27H28FNO2/c1-19-15-20(2)17-24(16-19)22-8-12-27(31-14-13-29(3)4)23(18-22)7-11-26(30)21-5-9-25(28)10-6-21/h5-12,15-18H,13-14H2,1-4H3 |
| InChIKey | PILDGSZSLZABAJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|